C27H25F3N2O3 — CID 55781955
N-[4-(3,3-diphenylpropanoylamino)-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide (PubChem CID 55781955) has the molecular formula C27H25F3N2O3 and a molecular weight of 482.50 g/mol. Its IUPAC name is N-[4-(3,3-diphenylpropanoylamino)-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide.
| Compound Name | N-[4-(3,3-diphenylpropanoylamino)-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
|---|---|
| PubChem CID | 55781955 |
| Molecular Formula | C27H25F3N2O3 |
| Molecular Weight | 482.50 g/mol |
| Exact Mass | 482.18 |
| IUPAC Name | N-[4-(3,3-diphenylpropanoylamino)-3-(trifluoromethyl)phenyl]oxolane-2-carboxamide |
| SMILES | O=C(CC(c1ccccc1)c1ccccc1)Nc1ccc(NC(=O)C2CCCO2)cc1C(F)(F)F |
| InChI | InChI=1S/C27H25F3N2O3/c28-27(29,30)22-16-20(31-26(34)24-12-7-15-35-24)13-14-23(22)32-25(33)17-21(18-8-3-1-4-9-18)19-10-5-2-6-11-19/h1-6,8-11,13-14,16,21,24H,7,12,15,17H2,(H,31,34)(H,32,33) |
| InChIKey | XMUIXHBPIJPLRC-UHFFFAOYSA-N |
| XLogP | 5.98 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.50 |
| LogP ≤ 5 | 5.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |