C11H14Cl2N4O3 — CID 88689423
1-(2,6-dichloro-3,4-dimethoxyphenyl)-3-(N'-methylcarbamimidoyl)urea (PubChem CID 88689423) has the molecular formula C11H14Cl2N4O3 and a molecular weight of 321.16 g/mol. Its IUPAC name is 1-(2,6-dichloro-3,4-dimethoxyphenyl)-3-(N'-methylcarbamimidoyl)urea.
| Compound Name | 1-(2,6-dichloro-3,4-dimethoxyphenyl)-3-(N'-methylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 88689423 |
| Molecular Formula | C11H14Cl2N4O3 |
| Molecular Weight | 321.16 g/mol |
| Exact Mass | 320.04 |
| IUPAC Name | 1-(2,6-dichloro-3,4-dimethoxyphenyl)-3-(N'-methylcarbamimidoyl)urea |
| SMILES | C/N=C(\N)NC(=O)Nc1c(Cl)cc(OC)c(OC)c1Cl |
| InChI | InChI=1S/C11H14Cl2N4O3/c1-15-10(14)17-11(18)16-8-5(12)4-6(19-2)9(20-3)7(8)13/h4H,1-3H3,(H4,14,15,16,17,18) |
| InChIKey | KZKQHWHPANIUJU-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.16 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|