C17H19N3O5 — CID 108866717
2-amino-N-[(3,4,5-trimethoxyphenyl)carbamoyl]benzamide (PubChem CID 108866717) has the molecular formula C17H19N3O5 and a molecular weight of 345.36 g/mol. Its IUPAC name is 2-amino-N-[(3,4,5-trimethoxyphenyl)carbamoyl]benzamide.
| Compound Name | 2-amino-N-[(3,4,5-trimethoxyphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 108866717 |
| Molecular Formula | C17H19N3O5 |
| Molecular Weight | 345.36 g/mol |
| Exact Mass | 345.13 |
| IUPAC Name | 2-amino-N-[(3,4,5-trimethoxyphenyl)carbamoyl]benzamide |
| SMILES | COc1cc(NC(=O)NC(=O)c2ccccc2N)cc(OC)c1OC |
| InChI | InChI=1S/C17H19N3O5/c1-23-13-8-10(9-14(24-2)15(13)25-3)19-17(22)20-16(21)11-6-4-5-7-12(11)18/h4-9H,18H2,1-3H3,(H2,19,20,21,22) |
| InChIKey | VSWWZAYYFMOSHO-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.36 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|