C20H25N3O5 — CID 108869836
2-amino-N-[(3,4,5-triethoxyphenyl)carbamoyl]benzamide (PubChem CID 108869836) has the molecular formula C20H25N3O5 and a molecular weight of 387.44 g/mol. Its IUPAC name is 2-amino-N-[(3,4,5-triethoxyphenyl)carbamoyl]benzamide.
| Compound Name | 2-amino-N-[(3,4,5-triethoxyphenyl)carbamoyl]benzamide |
|---|---|
| PubChem CID | 108869836 |
| Molecular Formula | C20H25N3O5 |
| Molecular Weight | 387.44 g/mol |
| Exact Mass | 387.18 |
| IUPAC Name | 2-amino-N-[(3,4,5-triethoxyphenyl)carbamoyl]benzamide |
| SMILES | CCOc1cc(NC(=O)NC(=O)c2ccccc2N)cc(OCC)c1OCC |
| InChI | InChI=1S/C20H25N3O5/c1-4-26-16-11-13(12-17(27-5-2)18(16)28-6-3)22-20(25)23-19(24)14-9-7-8-10-15(14)21/h7-12H,4-6,21H2,1-3H3,(H2,22,23,24,25) |
| InChIKey | XOSLXJCAARPSNW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 111.91 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 387.44 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|