C18H20N4O5 — CID 110512071
2-amino-N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]benzamide (PubChem CID 110512071) has the molecular formula C18H20N4O5 and a molecular weight of 372.38 g/mol. Its IUPAC name is 2-amino-N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]benzamide.
| Compound Name | 2-amino-N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]benzamide |
|---|---|
| PubChem CID | 110512071 |
| Molecular Formula | C18H20N4O5 |
| Molecular Weight | 372.38 g/mol |
| Exact Mass | 372.14 |
| IUPAC Name | 2-amino-N-[(Z)-(3,4-diethoxy-5-nitrophenyl)methylideneamino]benzamide |
| SMILES | CCOc1cc(/C=N\NC(=O)c2ccccc2N)cc([N+](=O)[O-])c1OCC |
| InChI | InChI=1S/C18H20N4O5/c1-3-26-16-10-12(9-15(22(24)25)17(16)27-4-2)11-20-21-18(23)13-7-5-6-8-14(13)19/h5-11H,3-4,19H2,1-2H3,(H,21,23)/b20-11- |
| InChIKey | XGVUENXMQYLMSB-JAIQZWGSSA-N |
| XLogP | 2.74 |
| TPSA | 129.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|