C9H11ClN2O2 — CID 100828458
N-(4-amino-2-chloro-6-methoxyphenyl)acetamide (PubChem CID 100828458) has the molecular formula C9H11ClN2O2 and a molecular weight of 214.65 g/mol. Its IUPAC name is N-(4-amino-2-chloro-6-methoxyphenyl)acetamide.
| Compound Name | N-(4-amino-2-chloro-6-methoxyphenyl)acetamide |
|---|---|
| PubChem CID | 100828458 |
| Molecular Formula | C9H11ClN2O2 |
| Molecular Weight | 214.65 g/mol |
| Exact Mass | 214.05 |
| IUPAC Name | N-(4-amino-2-chloro-6-methoxyphenyl)acetamide |
| SMILES | COc1cc(N)cc(Cl)c1NC(C)=O |
| InChI | InChI=1S/C9H11ClN2O2/c1-5(13)12-9-7(10)3-6(11)4-8(9)14-2/h3-4H,11H2,1-2H3,(H,12,13) |
| InChIKey | SGPBIVXDHKDQQD-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 64.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.65 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|