C17H18Cl2N2O3 — CID 100829792
N-(4-amino-2-chloro-6-methoxyphenyl)-2-(2-chloro-4,6-dimethylphenoxy)acetamide (PubChem CID 100829792) has the molecular formula C17H18Cl2N2O3 and a molecular weight of 369.25 g/mol. Its IUPAC name is N-(4-amino-2-chloro-6-methoxyphenyl)-2-(2-chloro-4,6-dimethylphenoxy)acetamide.
| Compound Name | N-(4-amino-2-chloro-6-methoxyphenyl)-2-(2-chloro-4,6-dimethylphenoxy)acetamide |
|---|---|
| PubChem CID | 100829792 |
| Molecular Formula | C17H18Cl2N2O3 |
| Molecular Weight | 369.25 g/mol |
| Exact Mass | 368.07 |
| IUPAC Name | N-(4-amino-2-chloro-6-methoxyphenyl)-2-(2-chloro-4,6-dimethylphenoxy)acetamide |
| SMILES | COc1cc(N)cc(Cl)c1NC(=O)COc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C17H18Cl2N2O3/c1-9-4-10(2)17(13(19)5-9)24-8-15(22)21-16-12(18)6-11(20)7-14(16)23-3/h4-7H,8,20H2,1-3H3,(H,21,22) |
| InChIKey | MGLLXSYZMRVEPT-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.25 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|