C13H18Cl2N4O3 — CID 54164619
1-(2,6-dichloro-4-hydroxy-3-methoxyphenyl)-3-(N,N'-diethylcarbamimidoyl)urea (PubChem CID 54164619) has the molecular formula C13H18Cl2N4O3 and a molecular weight of 349.22 g/mol. Its IUPAC name is 1-(2,6-dichloro-4-hydroxy-3-methoxyphenyl)-3-(N,N'-diethylcarbamimidoyl)urea.
| Compound Name | 1-(2,6-dichloro-4-hydroxy-3-methoxyphenyl)-3-(N,N'-diethylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 54164619 |
| Molecular Formula | C13H18Cl2N4O3 |
| Molecular Weight | 349.22 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 1-(2,6-dichloro-4-hydroxy-3-methoxyphenyl)-3-(N,N'-diethylcarbamimidoyl)urea |
| SMILES | CC/N=C(\NCC)NC(=O)Nc1c(Cl)cc(O)c(OC)c1Cl |
| InChI | InChI=1S/C13H18Cl2N4O3/c1-4-16-12(17-5-2)19-13(21)18-10-7(14)6-8(20)11(22-3)9(10)15/h6,20H,4-5H2,1-3H3,(H3,16,17,18,19,21) |
| InChIKey | OQTVSIOFOZUTDP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 94.98 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.22 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|