C15H23Cl2N3O2 — CID 111197712
2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(2-methoxyethoxy)ethyl]guanidine (PubChem CID 111197712) has the molecular formula C15H23Cl2N3O2 and a molecular weight of 348.27 g/mol. Its IUPAC name is 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(2-methoxyethoxy)ethyl]guanidine.
| Compound Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(2-methoxyethoxy)ethyl]guanidine |
|---|---|
| PubChem CID | 111197712 |
| Molecular Formula | C15H23Cl2N3O2 |
| Molecular Weight | 348.27 g/mol |
| Exact Mass | 347.12 |
| IUPAC Name | 2-[(2,4-dichlorophenyl)methyl]-1-ethyl-3-[2-(2-methoxyethoxy)ethyl]guanidine |
| SMILES | CCN/C(=N\Cc1ccc(Cl)cc1Cl)NCCOCCOC |
| InChI | InChI=1S/C15H23Cl2N3O2/c1-3-18-15(19-6-7-22-9-8-21-2)20-11-12-4-5-13(16)10-14(12)17/h4-5,10H,3,6-9,11H2,1-2H3,(H2,18,19,20) |
| InChIKey | CRMZVNPZVZCWIJ-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.27 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|