C11H15ClN4O — CID 13023376
1-(2-chloro-6-methylphenyl)-3-(N'-ethylcarbamimidoyl)urea (PubChem CID 13023376) has the molecular formula C11H15ClN4O and a molecular weight of 254.72 g/mol. Its IUPAC name is 1-(2-chloro-6-methylphenyl)-3-(N'-ethylcarbamimidoyl)urea.
| Compound Name | 1-(2-chloro-6-methylphenyl)-3-(N'-ethylcarbamimidoyl)urea |
|---|---|
| PubChem CID | 13023376 |
| Molecular Formula | C11H15ClN4O |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.09 |
| IUPAC Name | 1-(2-chloro-6-methylphenyl)-3-(N'-ethylcarbamimidoyl)urea |
| SMILES | CC/N=C(\N)NC(=O)Nc1c(C)cccc1Cl |
| InChI | InChI=1S/C11H15ClN4O/c1-3-14-10(13)16-11(17)15-9-7(2)5-4-6-8(9)12/h4-6H,3H2,1-2H3,(H4,13,14,15,16,17) |
| InChIKey | NZCBJNYSVRAKNT-UHFFFAOYSA-N |
| XLogP | 2.10 |
| TPSA | 79.51 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 2.10 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|