C10H11ClO4 — CID 84693978
1-(2-chloro-6-hydroxy-3,4-dimethoxyphenyl)ethanone (PubChem CID 84693978) has the molecular formula C10H11ClO4 and a molecular weight of 230.65 g/mol. Its IUPAC name is 1-(2-chloro-6-hydroxy-3,4-dimethoxyphenyl)ethanone.
| Compound Name | 1-(2-chloro-6-hydroxy-3,4-dimethoxyphenyl)ethanone |
|---|---|
| PubChem CID | 84693978 |
| Molecular Formula | C10H11ClO4 |
| Molecular Weight | 230.65 g/mol |
| Exact Mass | 230.03 |
| IUPAC Name | 1-(2-chloro-6-hydroxy-3,4-dimethoxyphenyl)ethanone |
| SMILES | COc1cc(O)c(C(C)=O)c(Cl)c1OC |
| InChI | InChI=1S/C10H11ClO4/c1-5(12)8-6(13)4-7(14-2)10(15-3)9(8)11/h4,13H,1-3H3 |
| InChIKey | VHGFHKHHBVKRHK-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 230.65 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |