C15H24N2O3 — CID 3759516
1-(1,1-dimethoxypropan-2-yl)-3-(2,4,6-trimethylphenyl)urea (PubChem CID 3759516) has the molecular formula C15H24N2O3 and a molecular weight of 280.37 g/mol. Its IUPAC name is 1-(1,1-dimethoxypropan-2-yl)-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-(1,1-dimethoxypropan-2-yl)-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 3759516 |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.37 g/mol |
| Exact Mass | 280.18 |
| IUPAC Name | 1-(1,1-dimethoxypropan-2-yl)-3-(2,4,6-trimethylphenyl)urea |
| SMILES | COC(OC)C(C)NC(=O)Nc1c(C)cc(C)cc1C |
| InChI | InChI=1S/C15H24N2O3/c1-9-7-10(2)13(11(3)8-9)17-15(18)16-12(4)14(19-5)20-6/h7-8,12,14H,1-6H3,(H2,16,17,18) |
| InChIKey | NDWFYTOTGZRLNZ-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 59.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.37 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|