C30H32Cl6N4O4 — CID 4064802
1-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-[(2,4,6-trimethylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]-3-(2,4,6-trimethylphenyl)urea (PubChem CID 4064802) has the molecular formula C30H32Cl6N4O4 and a molecular weight of 725.33 g/mol. Its IUPAC name is 1-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-[(2,4,6-trimethylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]-3-(2,4,6-trimethylphenyl)urea.
| Compound Name | 1-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-[(2,4,6-trimethylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]-3-(2,4,6-trimethylphenyl)urea |
|---|---|
| PubChem CID | 4064802 |
| Molecular Formula | C30H32Cl6N4O4 |
| Molecular Weight | 725.33 g/mol |
| Exact Mass | 722.06 |
| IUPAC Name | 1-[2,2,2-trichloro-1-[2-[2,2,2-trichloro-1-[(2,4,6-trimethylphenyl)carbamoylamino]ethoxy]phenoxy]ethyl]-3-(2,4,6-trimethylphenyl)urea |
| SMILES | Cc1cc(C)c(NC(=O)NC(Oc2ccccc2OC(NC(=O)Nc2c(C)cc(C)cc2C)C(Cl)(Cl)Cl)C(Cl)(Cl)Cl)c(C)c1 |
| InChI | InChI=1S/C30H32Cl6N4O4/c1-15-11-17(3)23(18(4)12-15)37-27(41)39-25(29(31,32)33)43-21-9-7-8-10-22(21)44-26(30(34,35)36)40-28(42)38-24-19(5)13-16(2)14-20(24)6/h7-14,25-26H,1-6H3,(H2,37,39,41)(H2,38,40,42) |
| InChIKey | PVQBQHUBWNNHMC-UHFFFAOYSA-N |
| XLogP | 9.33 |
| TPSA | 100.72 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 725.33 |
| LogP ≤ 5 | 9.33 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'} |
|---|