C12H17ClN2O2 — CID 95155199
1-(2-chloro-4,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]urea (PubChem CID 95155199) has the molecular formula C12H17ClN2O2 and a molecular weight of 256.73 g/mol. Its IUPAC name is 1-(2-chloro-4,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]urea.
| Compound Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]urea |
|---|---|
| PubChem CID | 95155199 |
| Molecular Formula | C12H17ClN2O2 |
| Molecular Weight | 256.73 g/mol |
| Exact Mass | 256.10 |
| IUPAC Name | 1-(2-chloro-4,6-dimethylphenyl)-3-[(2R)-1-hydroxypropan-2-yl]urea |
| SMILES | Cc1cc(C)c(NC(=O)N[C@H](C)CO)c(Cl)c1 |
| InChI | InChI=1S/C12H17ClN2O2/c1-7-4-8(2)11(10(13)5-7)15-12(17)14-9(3)6-16/h4-5,9,16H,6H2,1-3H3,(H2,14,15,17)/t9-/m1/s1 |
| InChIKey | PCENUBKNATZAIJ-SECBINFHSA-N |
| XLogP | 2.46 |
| TPSA | 61.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 256.73 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |