C18H30N4O — CID 152745111
1-butyl-3-(N'-butylcarbamimidoyl)-1-(2,6-dimethylphenyl)urea (PubChem CID 152745111) has the molecular formula C18H30N4O and a molecular weight of 318.47 g/mol. Its IUPAC name is 1-butyl-3-(N'-butylcarbamimidoyl)-1-(2,6-dimethylphenyl)urea.
| Compound Name | 1-butyl-3-(N'-butylcarbamimidoyl)-1-(2,6-dimethylphenyl)urea |
|---|---|
| PubChem CID | 152745111 |
| Molecular Formula | C18H30N4O |
| Molecular Weight | 318.47 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | 1-butyl-3-(N'-butylcarbamimidoyl)-1-(2,6-dimethylphenyl)urea |
| SMILES | CCCC/N=C(\N)NC(=O)N(CCCC)c1c(C)cccc1C |
| InChI | InChI=1S/C18H30N4O/c1-5-7-12-20-17(19)21-18(23)22(13-8-6-2)16-14(3)10-9-11-15(16)4/h9-11H,5-8,12-13H2,1-4H3,(H3,19,20,21,23) |
| InChIKey | GHYFZUJLZMZLNG-UHFFFAOYSA-N |
| XLogP | 3.73 |
| TPSA | 70.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.47 |
| LogP ≤ 5 | 3.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|