C19H32N2O — CID 129362140
(2R)-N-butyl-2-(butylamino)-N-(2,6-dimethylphenyl)propanamide (PubChem CID 129362140) has the molecular formula C19H32N2O and a molecular weight of 304.48 g/mol. Its IUPAC name is (2R)-N-butyl-2-(butylamino)-N-(2,6-dimethylphenyl)propanamide.
| Compound Name | (2R)-N-butyl-2-(butylamino)-N-(2,6-dimethylphenyl)propanamide |
|---|---|
| PubChem CID | 129362140 |
| Molecular Formula | C19H32N2O |
| Molecular Weight | 304.48 g/mol |
| Exact Mass | 304.25 |
| IUPAC Name | (2R)-N-butyl-2-(butylamino)-N-(2,6-dimethylphenyl)propanamide |
| SMILES | CCCCN[C@H](C)C(=O)N(CCCC)c1c(C)cccc1C |
| InChI | InChI=1S/C19H32N2O/c1-6-8-13-20-17(5)19(22)21(14-9-7-2)18-15(3)11-10-12-16(18)4/h10-12,17,20H,6-9,13-14H2,1-5H3/t17-/m1/s1 |
| InChIKey | FRTNLSMKXBYECR-QGZVFWFLSA-N |
| XLogP | 4.21 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.48 |
| LogP ≤ 5 | 4.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|