C12H17Cl3N4O — CID 104882713
1-amino-2-(3-ethoxypropyl)-3-(2,4,6-trichlorophenyl)guanidine (PubChem CID 104882713) has the molecular formula C12H17Cl3N4O and a molecular weight of 339.65 g/mol. Its IUPAC name is 1-amino-2-(3-ethoxypropyl)-3-(2,4,6-trichlorophenyl)guanidine.
| Compound Name | 1-amino-2-(3-ethoxypropyl)-3-(2,4,6-trichlorophenyl)guanidine |
|---|---|
| PubChem CID | 104882713 |
| Molecular Formula | C12H17Cl3N4O |
| Molecular Weight | 339.65 g/mol |
| Exact Mass | 338.05 |
| IUPAC Name | 1-amino-2-(3-ethoxypropyl)-3-(2,4,6-trichlorophenyl)guanidine |
| SMILES | CCOCCC/N=C(\NN)Nc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C12H17Cl3N4O/c1-2-20-5-3-4-17-12(19-16)18-11-9(14)6-8(13)7-10(11)15/h6-7H,2-5,16H2,1H3,(H2,17,18,19) |
| InChIKey | IRZQGLCQRVHYCO-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 71.67 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 339.65 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|