C10H13BrCl2N4 — CID 104882726
1-amino-3-(4-bromo-2,6-dichlorophenyl)-2-propylguanidine (PubChem CID 104882726) has the molecular formula C10H13BrCl2N4 and a molecular weight of 340.05 g/mol. Its IUPAC name is 1-amino-3-(4-bromo-2,6-dichlorophenyl)-2-propylguanidine.
| Compound Name | 1-amino-3-(4-bromo-2,6-dichlorophenyl)-2-propylguanidine |
|---|---|
| PubChem CID | 104882726 |
| Molecular Formula | C10H13BrCl2N4 |
| Molecular Weight | 340.05 g/mol |
| Exact Mass | 337.97 |
| IUPAC Name | 1-amino-3-(4-bromo-2,6-dichlorophenyl)-2-propylguanidine |
| SMILES | CCC/N=C(\NN)Nc1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C10H13BrCl2N4/c1-2-3-15-10(17-14)16-9-7(12)4-6(11)5-8(9)13/h4-5H,2-3,14H2,1H3,(H2,15,16,17) |
| InChIKey | YRDRLKZZTHPRIG-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 62.44 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.05 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|