C10H13BrClN3 — CID 81307492
N-amino-4-bromo-3-chloro-N'-propylbenzenecarboximidamide (PubChem CID 81307492) has the molecular formula C10H13BrClN3 and a molecular weight of 290.59 g/mol. Its IUPAC name is N-amino-4-bromo-3-chloro-N'-propylbenzenecarboximidamide.
| Compound Name | N-amino-4-bromo-3-chloro-N'-propylbenzenecarboximidamide |
|---|---|
| PubChem CID | 81307492 |
| Molecular Formula | C10H13BrClN3 |
| Molecular Weight | 290.59 g/mol |
| Exact Mass | 289.00 |
| IUPAC Name | N-amino-4-bromo-3-chloro-N'-propylbenzenecarboximidamide |
| SMILES | CCC/N=C(\NN)c1ccc(Br)c(Cl)c1 |
| InChI | InChI=1S/C10H13BrClN3/c1-2-5-14-10(15-13)7-3-4-8(11)9(12)6-7/h3-4,6H,2,5,13H2,1H3,(H,14,15) |
| InChIKey | FNMRNIDSVVFONY-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.59 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|