C12H19N3 — CID 61360666
N-amino-3,5-dimethyl-N'-propylbenzenecarboximidamide (PubChem CID 61360666) has the molecular formula C12H19N3 and a molecular weight of 205.30 g/mol. Its IUPAC name is N-amino-3,5-dimethyl-N'-propylbenzenecarboximidamide.
| Compound Name | N-amino-3,5-dimethyl-N'-propylbenzenecarboximidamide |
|---|---|
| PubChem CID | 61360666 |
| Molecular Formula | C12H19N3 |
| Molecular Weight | 205.30 g/mol |
| Exact Mass | 205.16 |
| IUPAC Name | N-amino-3,5-dimethyl-N'-propylbenzenecarboximidamide |
| SMILES | CCC/N=C(\NN)c1cc(C)cc(C)c1 |
| InChI | InChI=1S/C12H19N3/c1-4-5-14-12(15-13)11-7-9(2)6-10(3)8-11/h6-8H,4-5,13H2,1-3H3,(H,14,15) |
| InChIKey | PZMPSGGNMFSNJQ-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 50.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 205.30 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|