C8H17N5O2S — CID 106283726
3-(methylamino)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide (PubChem CID 106283726) has the molecular formula C8H17N5O2S and a molecular weight of 247.32 g/mol. Its IUPAC name is 3-(methylamino)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide.
| Compound Name | 3-(methylamino)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide |
|---|---|
| PubChem CID | 106283726 |
| Molecular Formula | C8H17N5O2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.11 |
| IUPAC Name | 3-(methylamino)-N-[1-(1H-1,2,4-triazol-5-yl)ethyl]propane-1-sulfonamide |
| SMILES | CNCCCS(=O)(=O)NC(C)c1ncn[nH]1 |
| InChI | InChI=1S/C8H17N5O2S/c1-7(8-10-6-11-12-8)13-16(14,15)5-3-4-9-2/h6-7,9,13H,3-5H2,1-2H3,(H,10,11,12) |
| InChIKey | HKJNIMISGRGKPC-UHFFFAOYSA-N |
| XLogP | -0.61 |
| TPSA | 99.77 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | -0.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|