C11H20N2S — CID 115726922
N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pentan-2-amine (PubChem CID 115726922) has the molecular formula C11H20N2S and a molecular weight of 212.36 g/mol. Its IUPAC name is N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pentan-2-amine.
| Compound Name | N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pentan-2-amine |
|---|---|
| PubChem CID | 115726922 |
| Molecular Formula | C11H20N2S |
| Molecular Weight | 212.36 g/mol |
| Exact Mass | 212.13 |
| IUPAC Name | N-[1-(5-methyl-1,3-thiazol-2-yl)ethyl]pentan-2-amine |
| SMILES | CCCC(C)NC(C)c1ncc(C)s1 |
| InChI | InChI=1S/C11H20N2S/c1-5-6-8(2)13-10(4)11-12-7-9(3)14-11/h7-8,10,13H,5-6H2,1-4H3 |
| InChIKey | CDSSWDAENNIVGV-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.36 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |