C12H12Cl2N2O2S2 — CID 64607266
5,6-dichloro-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-3-sulfonamide (PubChem CID 64607266) has the molecular formula C12H12Cl2N2O2S2 and a molecular weight of 351.28 g/mol. Its IUPAC name is 5,6-dichloro-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-3-sulfonamide.
| Compound Name | 5,6-dichloro-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-3-sulfonamide |
|---|---|
| PubChem CID | 64607266 |
| Molecular Formula | C12H12Cl2N2O2S2 |
| Molecular Weight | 351.28 g/mol |
| Exact Mass | 349.97 |
| IUPAC Name | 5,6-dichloro-N-[1-(5-methylthiophen-2-yl)ethyl]pyridine-3-sulfonamide |
| SMILES | Cc1ccc(C(C)NS(=O)(=O)c2cnc(Cl)c(Cl)c2)s1 |
| InChI | InChI=1S/C12H12Cl2N2O2S2/c1-7-3-4-11(19-7)8(2)16-20(17,18)9-5-10(13)12(14)15-6-9/h3-6,8,16H,1-2H3 |
| InChIKey | MUDRMIXHHLXBQN-UHFFFAOYSA-N |
| XLogP | 3.80 |
| TPSA | 59.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.28 |
| LogP ≤ 5 | 3.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|