C11H12BrCl2NO4S — CID 43631162
2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]pentanoic acid (PubChem CID 43631162) has the molecular formula C11H12BrCl2NO4S and a molecular weight of 405.10 g/mol. Its IUPAC name is 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]pentanoic acid.
| Compound Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]pentanoic acid |
|---|---|
| PubChem CID | 43631162 |
| Molecular Formula | C11H12BrCl2NO4S |
| Molecular Weight | 405.10 g/mol |
| Exact Mass | 402.90 |
| IUPAC Name | 2-[(4-bromo-2,6-dichlorophenyl)sulfonylamino]pentanoic acid |
| SMILES | CCCC(NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl)C(=O)O |
| InChI | InChI=1S/C11H12BrCl2NO4S/c1-2-3-9(11(16)17)15-20(18,19)10-7(13)4-6(12)5-8(10)14/h4-5,9,15H,2-3H2,1H3,(H,16,17) |
| InChIKey | AIIPLXNFHJJWER-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 83.47 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.10 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |