C10H10Cl3NO5S — CID 61244228
4-hydroxy-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanoic acid (PubChem CID 61244228) has the molecular formula C10H10Cl3NO5S and a molecular weight of 362.62 g/mol. Its IUPAC name is 4-hydroxy-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanoic acid.
| Compound Name | 4-hydroxy-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanoic acid |
|---|---|
| PubChem CID | 61244228 |
| Molecular Formula | C10H10Cl3NO5S |
| Molecular Weight | 362.62 g/mol |
| Exact Mass | 360.93 |
| IUPAC Name | 4-hydroxy-2-[(2,4,6-trichlorophenyl)sulfonylamino]butanoic acid |
| SMILES | O=C(O)C(CCO)NS(=O)(=O)c1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C10H10Cl3NO5S/c11-5-3-6(12)9(7(13)4-5)20(18,19)14-8(1-2-15)10(16)17/h3-4,8,14-15H,1-2H2,(H,16,17) |
| InChIKey | MBRUXSOOPMQUAD-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.62 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |