C10H11F2NO5S — CID 104935044
(2S)-2-[(2,6-difluorophenyl)sulfonylamino]-4-hydroxybutanoic acid (PubChem CID 104935044) has the molecular formula C10H11F2NO5S and a molecular weight of 295.26 g/mol. Its IUPAC name is (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-4-hydroxybutanoic acid.
| Compound Name | (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-4-hydroxybutanoic acid |
|---|---|
| PubChem CID | 104935044 |
| Molecular Formula | C10H11F2NO5S |
| Molecular Weight | 295.26 g/mol |
| Exact Mass | 295.03 |
| IUPAC Name | (2S)-2-[(2,6-difluorophenyl)sulfonylamino]-4-hydroxybutanoic acid |
| SMILES | O=C(O)[C@H](CCO)NS(=O)(=O)c1c(F)cccc1F |
| InChI | InChI=1S/C10H11F2NO5S/c11-6-2-1-3-7(12)9(6)19(17,18)13-8(4-5-14)10(15)16/h1-3,8,13-14H,4-5H2,(H,15,16)/t8-/m0/s1 |
| InChIKey | PZBMIQBNDLHBQL-QMMMGPOBSA-N |
| XLogP | 0.08 |
| TPSA | 103.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.26 |
| LogP ≤ 5 | 0.08 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |