C11H13BrCl3NO3S — CID 106158302
4-bromo-2,6-dichloro-N-(4-chloro-1-methoxybutan-2-yl)benzenesulfonamide (PubChem CID 106158302) has the molecular formula C11H13BrCl3NO3S and a molecular weight of 425.56 g/mol. Its IUPAC name is 4-bromo-2,6-dichloro-N-(4-chloro-1-methoxybutan-2-yl)benzenesulfonamide.
| Compound Name | 4-bromo-2,6-dichloro-N-(4-chloro-1-methoxybutan-2-yl)benzenesulfonamide |
|---|---|
| PubChem CID | 106158302 |
| Molecular Formula | C11H13BrCl3NO3S |
| Molecular Weight | 425.56 g/mol |
| Exact Mass | 422.89 |
| IUPAC Name | 4-bromo-2,6-dichloro-N-(4-chloro-1-methoxybutan-2-yl)benzenesulfonamide |
| SMILES | COCC(CCCl)NS(=O)(=O)c1c(Cl)cc(Br)cc1Cl |
| InChI | InChI=1S/C11H13BrCl3NO3S/c1-19-6-8(2-3-13)16-20(17,18)11-9(14)4-7(12)5-10(11)15/h4-5,8,16H,2-3,6H2,1H3 |
| InChIKey | RQNSEZCKHXQKSR-UHFFFAOYSA-N |
| XLogP | 3.68 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.56 |
| LogP ≤ 5 | 3.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|