C10H15BrClNO3S2 — CID 106158328
5-bromo-N-(4-chloro-1-methoxybutan-2-yl)-2-methylthiophene-3-sulfonamide (PubChem CID 106158328) has the molecular formula C10H15BrClNO3S2 and a molecular weight of 376.73 g/mol. Its IUPAC name is 5-bromo-N-(4-chloro-1-methoxybutan-2-yl)-2-methylthiophene-3-sulfonamide.
| Compound Name | 5-bromo-N-(4-chloro-1-methoxybutan-2-yl)-2-methylthiophene-3-sulfonamide |
|---|---|
| PubChem CID | 106158328 |
| Molecular Formula | C10H15BrClNO3S2 |
| Molecular Weight | 376.73 g/mol |
| Exact Mass | 374.94 |
| IUPAC Name | 5-bromo-N-(4-chloro-1-methoxybutan-2-yl)-2-methylthiophene-3-sulfonamide |
| SMILES | COCC(CCCl)NS(=O)(=O)c1cc(Br)sc1C |
| InChI | InChI=1S/C10H15BrClNO3S2/c1-7-9(5-10(11)17-7)18(14,15)13-8(3-4-12)6-16-2/h5,8,13H,3-4,6H2,1-2H3 |
| InChIKey | STAFQNYBQLCZQD-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.73 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|