C12H14BrFN2O2S — CID 106223824
5-amino-2-bromo-4-fluoro-N-hex-1-yn-3-ylbenzenesulfonamide (PubChem CID 106223824) has the molecular formula C12H14BrFN2O2S and a molecular weight of 349.23 g/mol. Its IUPAC name is 5-amino-2-bromo-4-fluoro-N-hex-1-yn-3-ylbenzenesulfonamide.
| Compound Name | 5-amino-2-bromo-4-fluoro-N-hex-1-yn-3-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 106223824 |
| Molecular Formula | C12H14BrFN2O2S |
| Molecular Weight | 349.23 g/mol |
| Exact Mass | 347.99 |
| IUPAC Name | 5-amino-2-bromo-4-fluoro-N-hex-1-yn-3-ylbenzenesulfonamide |
| SMILES | C#CC(CCC)NS(=O)(=O)c1cc(N)c(F)cc1Br |
| InChI | InChI=1S/C12H14BrFN2O2S/c1-3-5-8(4-2)16-19(17,18)12-7-11(15)10(14)6-9(12)13/h2,6-8,16H,3,5,15H2,1H3 |
| InChIKey | QIRVGBIBWAUQJL-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 72.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.23 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|