C14H15F3N2O4S — CID 154350671
2-[cyclopent-3-en-1-yl(methyl)amino]-5-sulfamoyl-4-(trifluoromethyl)benzoic acid (PubChem CID 154350671) has the molecular formula C14H15F3N2O4S and a molecular weight of 364.35 g/mol. Its IUPAC name is 2-[cyclopent-3-en-1-yl(methyl)amino]-5-sulfamoyl-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-[cyclopent-3-en-1-yl(methyl)amino]-5-sulfamoyl-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 154350671 |
| Molecular Formula | C14H15F3N2O4S |
| Molecular Weight | 364.35 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 2-[cyclopent-3-en-1-yl(methyl)amino]-5-sulfamoyl-4-(trifluoromethyl)benzoic acid |
| SMILES | CN(c1cc(C(F)(F)F)c(S(N)(=O)=O)cc1C(=O)O)C1CC=CC1 |
| InChI | InChI=1S/C14H15F3N2O4S/c1-19(8-4-2-3-5-8)11-7-10(14(15,16)17)12(24(18,22)23)6-9(11)13(20)21/h2-3,6-8H,4-5H2,1H3,(H,20,21)(H2,18,22,23) |
| InChIKey | NUNKCDONHJUKBV-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.35 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|