C11H13F3N2O4S — CID 122059447
3-[N-methyl-4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid (PubChem CID 122059447) has the molecular formula C11H13F3N2O4S and a molecular weight of 326.30 g/mol. Its IUPAC name is 3-[N-methyl-4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid.
| Compound Name | 3-[N-methyl-4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid |
|---|---|
| PubChem CID | 122059447 |
| Molecular Formula | C11H13F3N2O4S |
| Molecular Weight | 326.30 g/mol |
| Exact Mass | 326.05 |
| IUPAC Name | 3-[N-methyl-4-sulfamoyl-3-(trifluoromethyl)anilino]propanoic acid |
| SMILES | CN(CCC(=O)O)c1ccc(S(N)(=O)=O)c(C(F)(F)F)c1 |
| InChI | InChI=1S/C11H13F3N2O4S/c1-16(5-4-10(17)18)7-2-3-9(21(15,19)20)8(6-7)11(12,13)14/h2-3,6H,4-5H2,1H3,(H,17,18)(H2,15,19,20) |
| InChIKey | XEMBIXLKGIYJLZ-UHFFFAOYSA-N |
| XLogP | 1.26 |
| TPSA | 100.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.30 |
| LogP ≤ 5 | 1.26 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |