C10H8F4O4S — CID 174640782
3-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonylpropanoic acid (PubChem CID 174640782) has the molecular formula C10H8F4O4S and a molecular weight of 300.23 g/mol. Its IUPAC name is 3-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonylpropanoic acid.
| Compound Name | 3-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonylpropanoic acid |
|---|---|
| PubChem CID | 174640782 |
| Molecular Formula | C10H8F4O4S |
| Molecular Weight | 300.23 g/mol |
| Exact Mass | 300.01 |
| IUPAC Name | 3-[4-fluoro-2-(trifluoromethyl)phenyl]sulfonylpropanoic acid |
| SMILES | O=C(O)CCS(=O)(=O)c1ccc(F)cc1C(F)(F)F |
| InChI | InChI=1S/C10H8F4O4S/c11-6-1-2-8(7(5-6)10(12,13)14)19(17,18)4-3-9(15)16/h1-2,5H,3-4H2,(H,15,16) |
| InChIKey | UINKDWCIYUHWFN-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.23 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |