C19H16F6O4S — CID 11683900
3-[2-[4-ethylsulfonyl-3-(trifluoromethyl)phenyl]-4-(trifluoromethyl)phenyl]propanoic acid (PubChem CID 11683900) has the molecular formula C19H16F6O4S and a molecular weight of 454.39 g/mol. Its IUPAC name is 3-[2-[4-ethylsulfonyl-3-(trifluoromethyl)phenyl]-4-(trifluoromethyl)phenyl]propanoic acid.
| Compound Name | 3-[2-[4-ethylsulfonyl-3-(trifluoromethyl)phenyl]-4-(trifluoromethyl)phenyl]propanoic acid |
|---|---|
| PubChem CID | 11683900 |
| Molecular Formula | C19H16F6O4S |
| Molecular Weight | 454.39 g/mol |
| Exact Mass | 454.07 |
| IUPAC Name | 3-[2-[4-ethylsulfonyl-3-(trifluoromethyl)phenyl]-4-(trifluoromethyl)phenyl]propanoic acid |
| SMILES | CCS(=O)(=O)c1ccc(-c2cc(C(F)(F)F)ccc2CCC(=O)O)cc1C(F)(F)F |
| InChI | InChI=1S/C19H16F6O4S/c1-2-30(28,29)16-7-4-12(9-15(16)19(23,24)25)14-10-13(18(20,21)22)6-3-11(14)5-8-17(26)27/h3-4,6-7,9-10H,2,5,8H2,1H3,(H,26,27) |
| InChIKey | UXKUYMYXMWFKRH-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 71.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.39 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |