C18H19F3O3 — CID 68833126
3-[2-butyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoic acid (PubChem CID 68833126) has the molecular formula C18H19F3O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is 3-[2-butyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoic acid.
| Compound Name | 3-[2-butyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoic acid |
|---|---|
| PubChem CID | 68833126 |
| Molecular Formula | C18H19F3O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | 3-[2-butyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoic acid |
| SMILES | CCCCc1oc(-c2ccc(C(F)(F)F)cc2)cc1CCC(=O)O |
| InChI | InChI=1S/C18H19F3O3/c1-2-3-4-15-13(7-10-17(22)23)11-16(24-15)12-5-8-14(9-6-12)18(19,20)21/h5-6,8-9,11H,2-4,7,10H2,1H3,(H,22,23) |
| InChIKey | AEDDUOXGWCAVEY-UHFFFAOYSA-N |
| XLogP | 5.33 |
| TPSA | 50.44 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 5.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |