C27H26F3NO4S — CID 142869575
2-[[3-[3-[2-but-3-enyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoylamino]phenyl]methylsulfanyl]acetic acid (PubChem CID 142869575) has the molecular formula C27H26F3NO4S and a molecular weight of 517.57 g/mol. Its IUPAC name is 2-[[3-[3-[2-but-3-enyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoylamino]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[3-[2-but-3-enyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoylamino]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 142869575 |
| Molecular Formula | C27H26F3NO4S |
| Molecular Weight | 517.57 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 2-[[3-[3-[2-but-3-enyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propanoylamino]phenyl]methylsulfanyl]acetic acid |
| SMILES | C=CCCc1oc(-c2ccc(C(F)(F)F)cc2)cc1CCC(=O)Nc1cccc(CSCC(=O)O)c1 |
| InChI | InChI=1S/C27H26F3NO4S/c1-2-3-7-23-20(15-24(35-23)19-8-11-21(12-9-19)27(28,29)30)10-13-25(32)31-22-6-4-5-18(14-22)16-36-17-26(33)34/h2,4-6,8-9,11-12,14-15H,1,3,7,10,13,16-17H2,(H,31,32)(H,33,34) |
| InChIKey | PWGPFZQCNBJRIY-UHFFFAOYSA-N |
| XLogP | 6.97 |
| TPSA | 79.54 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.57 |
| LogP ≤ 5 | 6.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|