C16H17NO3S2 — CID 119240584
2-[[3-(3-thiophen-2-ylpropanoylamino)phenyl]methylsulfanyl]acetic acid (PubChem CID 119240584) has the molecular formula C16H17NO3S2 and a molecular weight of 335.45 g/mol. Its IUPAC name is 2-[[3-(3-thiophen-2-ylpropanoylamino)phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-(3-thiophen-2-ylpropanoylamino)phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119240584 |
| Molecular Formula | C16H17NO3S2 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.06 |
| IUPAC Name | 2-[[3-(3-thiophen-2-ylpropanoylamino)phenyl]methylsulfanyl]acetic acid |
| SMILES | O=C(O)CSCc1cccc(NC(=O)CCc2cccs2)c1 |
| InChI | InChI=1S/C16H17NO3S2/c18-15(7-6-14-5-2-8-22-14)17-13-4-1-3-12(9-13)10-21-11-16(19)20/h1-5,8-9H,6-7,10-11H2,(H,17,18)(H,19,20) |
| InChIKey | RIYUBEZUZGUDAA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 66.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |