C20H23NO4S — CID 119240560
2-[[3-[4-(4-methoxyphenyl)butanoylamino]phenyl]methylsulfanyl]acetic acid (PubChem CID 119240560) has the molecular formula C20H23NO4S and a molecular weight of 373.47 g/mol. Its IUPAC name is 2-[[3-[4-(4-methoxyphenyl)butanoylamino]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[4-(4-methoxyphenyl)butanoylamino]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119240560 |
| Molecular Formula | C20H23NO4S |
| Molecular Weight | 373.47 g/mol |
| Exact Mass | 373.13 |
| IUPAC Name | 2-[[3-[4-(4-methoxyphenyl)butanoylamino]phenyl]methylsulfanyl]acetic acid |
| SMILES | COc1ccc(CCCC(=O)Nc2cccc(CSCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C20H23NO4S/c1-25-18-10-8-15(9-11-18)4-3-7-19(22)21-17-6-2-5-16(12-17)13-26-14-20(23)24/h2,5-6,8-12H,3-4,7,13-14H2,1H3,(H,21,22)(H,23,24) |
| InChIKey | NLEFOTGLWQLJBL-UHFFFAOYSA-N |
| XLogP | 3.97 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.47 |
| LogP ≤ 5 | 3.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |