C19H21NO4S2 — CID 119240605
2-[[3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]phenyl]methylsulfanyl]acetic acid (PubChem CID 119240605) has the molecular formula C19H21NO4S2 and a molecular weight of 391.51 g/mol. Its IUPAC name is 2-[[3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]phenyl]methylsulfanyl]acetic acid.
| Compound Name | 2-[[3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]phenyl]methylsulfanyl]acetic acid |
|---|---|
| PubChem CID | 119240605 |
| Molecular Formula | C19H21NO4S2 |
| Molecular Weight | 391.51 g/mol |
| Exact Mass | 391.09 |
| IUPAC Name | 2-[[3-[3-(4-methoxyphenyl)sulfanylpropanoylamino]phenyl]methylsulfanyl]acetic acid |
| SMILES | COc1ccc(SCCC(=O)Nc2cccc(CSCC(=O)O)c2)cc1 |
| InChI | InChI=1S/C19H21NO4S2/c1-24-16-5-7-17(8-6-16)26-10-9-18(21)20-15-4-2-3-14(11-15)12-25-13-19(22)23/h2-8,11H,9-10,12-13H2,1H3,(H,20,21)(H,22,23) |
| InChIKey | AHWMYTQNEYPOOK-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 75.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.51 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |