C20H23NO5S — CID 120613867
3-[3-[3-(3,4-dimethoxyphenyl)sulfanylpropanoylamino]phenyl]propanoic acid (PubChem CID 120613867) has the molecular formula C20H23NO5S and a molecular weight of 389.47 g/mol. Its IUPAC name is 3-[3-[3-(3,4-dimethoxyphenyl)sulfanylpropanoylamino]phenyl]propanoic acid.
| Compound Name | 3-[3-[3-(3,4-dimethoxyphenyl)sulfanylpropanoylamino]phenyl]propanoic acid |
|---|---|
| PubChem CID | 120613867 |
| Molecular Formula | C20H23NO5S |
| Molecular Weight | 389.47 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-[3-[3-(3,4-dimethoxyphenyl)sulfanylpropanoylamino]phenyl]propanoic acid |
| SMILES | COc1ccc(SCCC(=O)Nc2cccc(CCC(=O)O)c2)cc1OC |
| InChI | InChI=1S/C20H23NO5S/c1-25-17-8-7-16(13-18(17)26-2)27-11-10-19(22)21-15-5-3-4-14(12-15)6-9-20(23)24/h3-5,7-8,12-13H,6,9-11H2,1-2H3,(H,21,22)(H,23,24) |
| InChIKey | UQNQHKAOCGGXNG-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 84.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.47 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |