C23H21F3O4 — CID 23074326
2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenyl]acetic acid (PubChem CID 23074326) has the molecular formula C23H21F3O4 and a molecular weight of 418.41 g/mol. Its IUPAC name is 2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenyl]acetic acid.
| Compound Name | 2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenyl]acetic acid |
|---|---|
| PubChem CID | 23074326 |
| Molecular Formula | C23H21F3O4 |
| Molecular Weight | 418.41 g/mol |
| Exact Mass | 418.14 |
| IUPAC Name | 2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenyl]acetic acid |
| SMILES | Cc1oc(-c2ccc(C(F)(F)F)cc2)cc1CCCOc1ccc(CC(=O)O)cc1 |
| InChI | InChI=1S/C23H21F3O4/c1-15-18(3-2-12-29-20-10-4-16(5-11-20)13-22(27)28)14-21(30-15)17-6-8-19(9-7-17)23(24,25)26/h4-11,14H,2-3,12-13H2,1H3,(H,27,28) |
| InChIKey | APLJONRTMFZCMP-UHFFFAOYSA-N |
| XLogP | 5.91 |
| TPSA | 59.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.41 |
| LogP ≤ 5 | 5.91 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|