C25H25F3O5 — CID 23074271
2-methyl-2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenoxy]propanoic acid (PubChem CID 23074271) has the molecular formula C25H25F3O5 and a molecular weight of 462.46 g/mol. Its IUPAC name is 2-methyl-2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenoxy]propanoic acid.
| Compound Name | 2-methyl-2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenoxy]propanoic acid |
|---|---|
| PubChem CID | 23074271 |
| Molecular Formula | C25H25F3O5 |
| Molecular Weight | 462.46 g/mol |
| Exact Mass | 462.17 |
| IUPAC Name | 2-methyl-2-[4-[3-[2-methyl-5-[4-(trifluoromethyl)phenyl]furan-3-yl]propoxy]phenoxy]propanoic acid |
| SMILES | Cc1oc(-c2ccc(C(F)(F)F)cc2)cc1CCCOc1ccc(OC(C)(C)C(=O)O)cc1 |
| InChI | InChI=1S/C25H25F3O5/c1-16-18(15-22(32-16)17-6-8-19(9-7-17)25(26,27)28)5-4-14-31-20-10-12-21(13-11-20)33-24(2,3)23(29)30/h6-13,15H,4-5,14H2,1-3H3,(H,29,30) |
| InChIKey | DQNNNCBOMLSLGQ-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 68.90 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.46 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|