C22H19F3O2 — CID 164679300
5-butyl-3-phenyl-6-[4-(trifluoromethyl)phenyl]pyran-2-one (PubChem CID 164679300) has the molecular formula C22H19F3O2 and a molecular weight of 372.39 g/mol. Its IUPAC name is 5-butyl-3-phenyl-6-[4-(trifluoromethyl)phenyl]pyran-2-one.
| Compound Name | 5-butyl-3-phenyl-6-[4-(trifluoromethyl)phenyl]pyran-2-one |
|---|---|
| PubChem CID | 164679300 |
| Molecular Formula | C22H19F3O2 |
| Molecular Weight | 372.39 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | 5-butyl-3-phenyl-6-[4-(trifluoromethyl)phenyl]pyran-2-one |
| SMILES | CCCCc1cc(-c2ccccc2)c(=O)oc1-c1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C22H19F3O2/c1-2-3-7-17-14-19(15-8-5-4-6-9-15)21(26)27-20(17)16-10-12-18(13-11-16)22(23,24)25/h4-6,8-14H,2-3,7H2,1H3 |
| InChIKey | CDSXMDBGYUVHCR-UHFFFAOYSA-N |
| XLogP | 6.34 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.39 |
| LogP ≤ 5 | 6.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |