C21H19ClO2 — CID 164678659
5-(4-chlorobutyl)-3,6-diphenylpyran-2-one (PubChem CID 164678659) has the molecular formula C21H19ClO2 and a molecular weight of 338.83 g/mol. Its IUPAC name is 5-(4-chlorobutyl)-3,6-diphenylpyran-2-one.
| Compound Name | 5-(4-chlorobutyl)-3,6-diphenylpyran-2-one |
|---|---|
| PubChem CID | 164678659 |
| Molecular Formula | C21H19ClO2 |
| Molecular Weight | 338.83 g/mol |
| Exact Mass | 338.11 |
| IUPAC Name | 5-(4-chlorobutyl)-3,6-diphenylpyran-2-one |
| SMILES | O=c1oc(-c2ccccc2)c(CCCCCl)cc1-c1ccccc1 |
| InChI | InChI=1S/C21H19ClO2/c22-14-8-7-13-18-15-19(16-9-3-1-4-10-16)21(23)24-20(18)17-11-5-2-6-12-17/h1-6,9-12,15H,7-8,13-14H2 |
| InChIKey | MWKAORQOUGHRGG-UHFFFAOYSA-N |
| XLogP | 5.54 |
| TPSA | 30.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.83 |
| LogP ≤ 5 | 5.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|