C13H10F3NO3 — CID 115087405
3-[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid (PubChem CID 115087405) has the molecular formula C13H10F3NO3 and a molecular weight of 285.22 g/mol. Its IUPAC name is 3-[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid.
| Compound Name | 3-[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 115087405 |
| Molecular Formula | C13H10F3NO3 |
| Molecular Weight | 285.22 g/mol |
| Exact Mass | 285.06 |
| IUPAC Name | 3-[2-[4-(trifluoromethyl)phenyl]-1,3-oxazol-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1cnc(-c2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C13H10F3NO3/c14-13(15,16)9-3-1-8(2-4-9)12-17-7-10(20-12)5-6-11(18)19/h1-4,7H,5-6H2,(H,18,19) |
| InChIKey | BVCLFGNLPJKIJR-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.22 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |