C14H12F3NO2 — CID 154324455
3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanamide (PubChem CID 154324455) has the molecular formula C14H12F3NO2 and a molecular weight of 283.25 g/mol. Its IUPAC name is 3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanamide.
| Compound Name | 3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanamide |
|---|---|
| PubChem CID | 154324455 |
| Molecular Formula | C14H12F3NO2 |
| Molecular Weight | 283.25 g/mol |
| Exact Mass | 283.08 |
| IUPAC Name | 3-[5-[4-(trifluoromethyl)phenyl]furan-2-yl]propanamide |
| SMILES | NC(=O)CCc1ccc(-c2ccc(C(F)(F)F)cc2)o1 |
| InChI | InChI=1S/C14H12F3NO2/c15-14(16,17)10-3-1-9(2-4-10)12-7-5-11(20-12)6-8-13(18)19/h1-5,7H,6,8H2,(H2,18,19) |
| InChIKey | CRVLSWWWEGUNHA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 56.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.25 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |