C72H36F18O6 — CID 71615619
2-[2,3,4,5,6-pentakis[5-[4-(trifluoromethyl)phenyl]furan-2-yl]phenyl]-5-[4-(trifluoromethyl)phenyl]furan (PubChem CID 71615619) has the molecular formula C72H36F18O6 and a molecular weight of 1339.04 g/mol. Its IUPAC name is 2-[2,3,4,5,6-pentakis[5-[4-(trifluoromethyl)phenyl]furan-2-yl]phenyl]-5-[4-(trifluoromethyl)phenyl]furan.
| Compound Name | 2-[2,3,4,5,6-pentakis[5-[4-(trifluoromethyl)phenyl]furan-2-yl]phenyl]-5-[4-(trifluoromethyl)phenyl]furan |
|---|---|
| PubChem CID | 71615619 |
| Molecular Formula | C72H36F18O6 |
| Molecular Weight | 1339.04 g/mol |
| Exact Mass | 1338.22 |
| IUPAC Name | 2-[2,3,4,5,6-pentakis[5-[4-(trifluoromethyl)phenyl]furan-2-yl]phenyl]-5-[4-(trifluoromethyl)phenyl]furan |
| SMILES | FC(F)(F)c1ccc(-c2ccc(-c3c(-c4ccc(-c5ccc(C(F)(F)F)cc5)o4)c(-c4ccc(-c5ccc(C(F)(F)F)cc5)o4)c(-c4ccc(-c5ccc(C(F)(F)F)cc5)o4)c(-c4ccc(-c5ccc(C(F)(F)F)cc5)o4)c3-c3ccc(-c4ccc(C(F)(F)F)cc4)o3)o2)cc1 |
| InChI | InChI=1S/C72H36F18O6/c73-67(74,75)43-13-1-37(2-14-43)49-25-31-55(91-49)61-62(56-32-26-50(92-56)38-3-15-44(16-4-38)68(76,77)78)64(58-34-28-52(94-58)40-7-19-46(20-8-40)70(82,83)84)66(60-36-30-54(96-60)42-11-23-48(24-12-42)72(88,89)90)65(59-35-29-53(95-59)41-9-21-47(22-10-41)71(85,86)87)63(61)57-33-27-51(93-57)39-5-17-45(18-6-39)69(79,80)81/h1-36H |
| InChIKey | KGOMJBVEJYCZQL-UHFFFAOYSA-N |
| XLogP | 25.36 |
| TPSA | 78.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 96 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 1339.04 |
| LogP ≤ 5 | 25.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |