C7H6F3NO2S — CID 106784034
3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanoic acid (PubChem CID 106784034) has the molecular formula C7H6F3NO2S and a molecular weight of 225.19 g/mol. Its IUPAC name is 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanoic acid.
| Compound Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanoic acid |
|---|---|
| PubChem CID | 106784034 |
| Molecular Formula | C7H6F3NO2S |
| Molecular Weight | 225.19 g/mol |
| Exact Mass | 225.01 |
| IUPAC Name | 3-[2-(trifluoromethyl)-1,3-thiazol-5-yl]propanoic acid |
| SMILES | O=C(O)CCc1cnc(C(F)(F)F)s1 |
| InChI | InChI=1S/C7H6F3NO2S/c8-7(9,10)6-11-3-4(14-6)1-2-5(12)13/h3H,1-2H2,(H,12,13) |
| InChIKey | MNILNSPZOOXEEJ-UHFFFAOYSA-N |
| XLogP | 2.18 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.19 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |