C14H18F3N3O5S — CID 154304142
2-(2-morpholin-4-ylethylamino)-5-sulfamoyl-4-(trifluoromethyl)benzoic acid (PubChem CID 154304142) has the molecular formula C14H18F3N3O5S and a molecular weight of 397.38 g/mol. Its IUPAC name is 2-(2-morpholin-4-ylethylamino)-5-sulfamoyl-4-(trifluoromethyl)benzoic acid.
| Compound Name | 2-(2-morpholin-4-ylethylamino)-5-sulfamoyl-4-(trifluoromethyl)benzoic acid |
|---|---|
| PubChem CID | 154304142 |
| Molecular Formula | C14H18F3N3O5S |
| Molecular Weight | 397.38 g/mol |
| Exact Mass | 397.09 |
| IUPAC Name | 2-(2-morpholin-4-ylethylamino)-5-sulfamoyl-4-(trifluoromethyl)benzoic acid |
| SMILES | NS(=O)(=O)c1cc(C(=O)O)c(NCCN2CCOCC2)cc1C(F)(F)F |
| InChI | InChI=1S/C14H18F3N3O5S/c15-14(16,17)10-8-11(19-1-2-20-3-5-25-6-4-20)9(13(21)22)7-12(10)26(18,23)24/h7-8,19H,1-6H2,(H,21,22)(H2,18,23,24) |
| InChIKey | MUYGHFODCWQGIP-UHFFFAOYSA-N |
| XLogP | 0.80 |
| TPSA | 121.96 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.38 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |