C10H5F6NO2 — CID 119008889
4-formyl-2,5-bis(trifluoromethyl)benzamide (PubChem CID 119008889) has the molecular formula C10H5F6NO2 and a molecular weight of 285.14 g/mol. Its IUPAC name is 4-formyl-2,5-bis(trifluoromethyl)benzamide.
| Compound Name | 4-formyl-2,5-bis(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 119008889 |
| Molecular Formula | C10H5F6NO2 |
| Molecular Weight | 285.14 g/mol |
| Exact Mass | 285.02 |
| IUPAC Name | 4-formyl-2,5-bis(trifluoromethyl)benzamide |
| SMILES | NC(=O)c1cc(C(F)(F)F)c(C=O)cc1C(F)(F)F |
| InChI | InChI=1S/C10H5F6NO2/c11-9(12,13)6-2-5(8(17)19)7(10(14,15)16)1-4(6)3-18/h1-3H,(H2,17,19) |
| InChIKey | DASZBTIOQBFZNA-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.14 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|