C10H3ClF6O2 — CID 118828279
2-formyl-4,5-bis(trifluoromethyl)benzoyl chloride (PubChem CID 118828279) has the molecular formula C10H3ClF6O2 and a molecular weight of 304.57 g/mol. Its IUPAC name is 2-formyl-4,5-bis(trifluoromethyl)benzoyl chloride.
| Compound Name | 2-formyl-4,5-bis(trifluoromethyl)benzoyl chloride |
|---|---|
| PubChem CID | 118828279 |
| Molecular Formula | C10H3ClF6O2 |
| Molecular Weight | 304.57 g/mol |
| Exact Mass | 303.97 |
| IUPAC Name | 2-formyl-4,5-bis(trifluoromethyl)benzoyl chloride |
| SMILES | O=Cc1cc(C(F)(F)F)c(C(F)(F)F)cc1C(=O)Cl |
| InChI | InChI=1S/C10H3ClF6O2/c11-8(19)5-2-7(10(15,16)17)6(9(12,13)14)1-4(5)3-18/h1-3H |
| InChIKey | VPMDVTASZYFFDP-UHFFFAOYSA-N |
| XLogP | 3.92 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.57 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|